Methoxyfenozide 240g/l SC of Insecticide Pesticide
An insectide approved for use in the EU and many other countries on a broad range of fruit and vegetables. It has a low aqueous solubility and a low volatility. Based on its chemical properties there is a high risk of leaching to groundwater and under some conditions it may be persistent in soil systems. It has a low oral toxicity to mammals and no significant risk issues to human health have been identified. It has a low toxicity to birds and honeybees but is relatively more toxic to aquatic species and earthworms.
Description: An insecticide used to control various insects including moths and butterflies
Example pests controlled: Codling moth; Lesser appleworm; Oriental fruit moth; Leafrollers; Loopers; Cotton bollworm; Armyworm; Bud moths
Example applications: Leafy vegetables; Fresh herbs; Lettuce; Salads; Herbs; Brassicas; Cotton; Pome fruit; Grapes; Sweetcorn; Maize; Peppers; Aubergines
Chemical structure:
| Isomerism |
- |
| Chemical formula |
C22H28N2O3 |
| Canonical SMILES |
CC1=CC(=CC(=C1)C(=O)N(C(C)(C)C)NC(=O)C2=C(C(=CC=C2)OC)C)C |
| Isomeric SMILES |
No data |
| International Chemical Identifier key (InChIKey) |
QCAWEPFNJXQPAN-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) |
InChI=1S/C22H28N2O3/c1-14-11-15(2)13-17(12-14)21(26)24(22(4,5)6)23-20(25)18-9-8-10-19(27-7)16(18)3/h8-13H,1-7H3,(H,23,25) |
General status:
| Pesticide type |
Insecticide |
| Substance group |
Diacylhydrazine |
| Minimum active substance purity |
970 g/kg |
| Known relevant impurities |
EU dossier - butylhydrazine |
| Substance origin |
Synthetic |
| Mode of action |
A moulting accelerator that is an agonist of the hormone 20-hydroxyecdysone |
| CAS RN |
161050-58-4 |
| EC number |
- |
| CIPAC number |
656 |
| US EPA chemical code |
121027 |
| PubChem CID |
105010 |
| Molecular mass (g mol-1) |
368.47 |
| PIN (Preferred Identification Name) |
- |
| IUPAC name |
N-tert-butyl-N'-(3-methoxy-o-toluoyl)-3,5-xylohydrazide |
| CAS name |
3-methoxy-2-methylbenzoic acid 2-(3,5-dimethylbenzoyl)-2-(1,1-dimethylethyl)hydrazide |
Audited Supplier 
Audited Supplier 
){kind=link}
){kind=link}