Appearance: | Oil Based |
---|---|
Usage: | Selective |
Composition: | Organic |
Colour: | White |
CAS 1: | 81406-37-3 |
Ec No. 1: | 279-752-9 |
Samples: |
---|
Customization: |
---|
Suppliers with verified business licenses
Isomerism | Fluroxypyr is not itself isomeric but the meptyl ester has a pair of enantiomers. |
Chemical formula | C15H21Cl2FN2O3 |
Canonical SMILES | CCCCCCC(C)OC(=O)COC1=NC(=C(C(=C1Cl)N)Cl)F |
Isomeric SMILES | No data |
International Chemical Identifier key (InChIKey) | OLZQTUCTGLHFTQ-UHFFFAOYSA-N |
International Chemical Identifier (InChI) | InChI=1S/C15H21Cl2FN2O3/c1-3-4-5-6-7-9(2)23-10(21)8-22-15-12(17)13(19)11(16)14(18)20-15/h9H,3-8H2,1-2H3,(H2,19,20) |
Pesticide type | Herbicide |
Substance group | Pyridine compound |
Minimum active substance purity | 950 g/kg |
Known relevant impurities | EU dossier - None declared |
Substance origin | Synthetic |
Mode of action | Selective, foliar uptake causing auxin-type response |
CAS RN | 81406-37-3 |
EC number | 279-752-9 |
CIPAC number | - |
US EPA chemical code | 128968 |
PubChem CID | 54745 |
Molecular mass (g mol-1) | 367.24 |
PIN (Preferred Identification Name) | rac-(2R)-octan-2-yl [(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]acetate |
IUPAC name | (RS)-1-methylheptyl 4-amino-3,5-dichloro-6-fluoro-2-pyridyloxyacetate |
CAS name | 1-methylheptyl ((4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy)acetate |
Isomerism | - |
Chemical formula | C6H3Cl3N2O2 |
Canonical SMILES | C1(=C(C(=NC(=C1Cl)Cl)C(=O)O)Cl)N |
Isomeric SMILES | No data |
International Chemical Identifier key (InChIKey) | NQQVFXUMIDALNH-UHFFFAOYSA-N |
International Chemical Identifier (InChI) | InChI=1S/C6H3Cl3N2O2/c7-1-3(10)2(8)5(9)11-4(1)6(12)13/h(H2,10,11)(H,12,13) |
Pesticide type | Herbicide |
Substance group | Pyridine compound |
Minimum active substance purity | 920 g/kg |
Known relevant impurities | EU dossier - hexachlorobenzene 0.005%, sulphuric acid 0.9% |
Substance origin | Synthetic |
Mode of action | Selective, systemic absorbed by roots and leaves and translocated. Synthetic auxin. |
CAS RN | 1918-02-1 |
EC number | 217-636-1 |
CIPAC number | 174 |
US EPA chemical code | 005101 |
PubChem CID | 15965 |
Molecular mass (g mol-1) | 241.46 |
PIN (Preferred Identification Name) | - |
IUPAC name | 4-amino-3,5,6-trichloropyridine-2-carboxylic acid |
CAS name | 4-amino-3,5,6-trichloro-2-pyridinecarboxylic acid |
Suppliers with verified business licenses