| Appearance: | Liquid |
|---|---|
| Application: | Fungicide, Bactericide |
| Application Fields: | Agricultural Fungicide |
| Composition: | Organic |
| CAS 1: | 188425-85-6 |
| Chemical Formula 1: | C18h12cl2n2o |
| Samples: |
|---|
| Customization: |
|---|
Suppliers with verified business licenses
Audited Supplier | Isomerism | - |
| Chemical formula | C18H12Cl2N2O |
| Canonical SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)Cl)NC(=O)C3=C(N=CC=C3)Cl |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | WYEMLYFITZORAB-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C18H12Cl2N2O/c19-13-9-7-12(8-10-13)14-4-1-2-6-16(14)22-18(23)15-5-3-11-21-17(15)20/h1-11H,(H,22,23)/f/h22H |
| Pesticide type | Fungicide |
| Substance group | Carboxamide |
| Minimum active substance purity | 960 g/kg |
| Known relevant impurities | EU dossier - none declared |
| Substance origin | Synthetic |
| Mode of action | Protectant, foliar absorption, translocates, inhibits spore germination and germ tude elongation. Succinate DeHydrogenase Inhibitor. |
| CAS RN | 188425-85-6 |
| EC number | - |
| CIPAC number | 673 |
| US EPA chemical code | 128008 |
| PubChem CID | 213013 |
| Molecular mass (g mol-1) | 343.21 |
| PIN (Preferred Identification Name) | 2-chloro-N-(4'-chloro[1,1'-biphenyl]-2-yl)pyridine-3-carboxamide |
| IUPAC name | 2-chloro-N-(4'-chlorobiphenyl-2-yl)nicotinamide |
| CAS name | 2-chloro-N-(4'-chloro[1,1'-biphenyl]-2-yl)-3-pyridinecarboxamide |
| Isomerism | Isomeric |
| Chemical formula | C18H19NO4 |
| Canonical SMILES | CC1=CC=CC=C1OCC2=CC=CC=C2C(=NOC)C(=O)OC |
| Isomeric SMILES | CC1=CC=CC=C1OCC2=CC=CC=C2/C(=N\OC)/C(=O)OC |
| International Chemical Identifier key (InChIKey) | ZOTBXTZVPHCKPN-HTXNQAPBSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C18H19NO4/c1-13-8-4-7-11-16(13)23-12-14-9-5-6-10-15(14)17(19-22-3)18(20)21-2/h4-11H,12H2,1-3H3/b19-17+ |
| Pesticide type | Fungicide, Bactericide |
| Substance group | Strobilurin |
| Minimum active substance purity | 934 |
| Known relevant impurities | EU dossier - Methanol <5 g/kg; Methyl chloride <1 g/kg; Toluene < 1 g/kg |
| Substance origin | Synthetic |
| Mode of action | Protective, curative, eradicative action and long residual effects, acts by binding to Qo site blocking electron transfer and respiration of the fungi |
| CAS RN | 143390-89-0 |
| EC number | 417-880-0 |
| CIPAC number | 568 |
| US EPA chemical code | 129111 |
| PubChem CID | 6112114 |
| Molecular mass (g mol-1) | 313.35 |
| PIN (Preferred Identification Name) | - |
| IUPAC name | methyl (E)-methoxyimino[α-(o-tolyloxy)-o-tolyl]acetate |
| CAS name | methyl (αE)-α-(methoxyimino)-2-((2-methylphenoxy)methyl)benzeneacetate |
Q:What products can SINO AGRO provide?
Suppliers with verified business licenses
Audited Supplier 
){kind=link}
){kind=link}